C15H14BrNO4 — CID 103492634
methyl 2-bromo-3-[(1-hydroxynaphthalene-2-carbonyl)amino]propanoate (PubChem CID 103492634) has the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. Its IUPAC name is methyl 2-bromo-3-[(1-hydroxynaphthalene-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(1-hydroxynaphthalene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103492634 |
| Molecular Formula | C15H14BrNO4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | methyl 2-bromo-3-[(1-hydroxynaphthalene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C15H14BrNO4/c1-21-15(20)12(16)8-17-14(19)11-7-6-9-4-2-3-5-10(9)13(11)18/h2-7,12,18H,8H2,1H3,(H,17,19) |
| InChIKey | YUQGJPBYPQYWRS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|