C9H10IN3O3 — CID 103493215
methyl 2-iodo-3-(pyrimidine-5-carbonylamino)propanoate (PubChem CID 103493215) has the molecular formula C9H10IN3O3 and a molecular weight of 335.10 g/mol. Its IUPAC name is methyl 2-iodo-3-(pyrimidine-5-carbonylamino)propanoate.
| Compound Name | methyl 2-iodo-3-(pyrimidine-5-carbonylamino)propanoate |
|---|---|
| PubChem CID | 103493215 |
| Molecular Formula | C9H10IN3O3 |
| Molecular Weight | 335.10 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | methyl 2-iodo-3-(pyrimidine-5-carbonylamino)propanoate |
| SMILES | COC(=O)C(I)CNC(=O)c1cncnc1 |
| InChI | InChI=1S/C9H10IN3O3/c1-16-9(15)7(10)4-13-8(14)6-2-11-5-12-3-6/h2-3,5,7H,4H2,1H3,(H,13,14) |
| InChIKey | LOCBJZPRLHALAX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.10 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|