C13H16INO5 — CID 103493347
methyl 3-[(2,4-dimethoxybenzoyl)amino]-2-iodopropanoate (PubChem CID 103493347) has the molecular formula C13H16INO5 and a molecular weight of 393.18 g/mol. Its IUPAC name is methyl 3-[(2,4-dimethoxybenzoyl)amino]-2-iodopropanoate.
| Compound Name | methyl 3-[(2,4-dimethoxybenzoyl)amino]-2-iodopropanoate |
|---|---|
| PubChem CID | 103493347 |
| Molecular Formula | C13H16INO5 |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | methyl 3-[(2,4-dimethoxybenzoyl)amino]-2-iodopropanoate |
| SMILES | COC(=O)C(I)CNC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H16INO5/c1-18-8-4-5-9(11(6-8)19-2)12(16)15-7-10(14)13(17)20-3/h4-6,10H,7H2,1-3H3,(H,15,16) |
| InChIKey | JXVQSYUNLFKIIC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|