C16H19FN2S — CID 103494115
1-(6-fluoro-2,3-dihydroindol-1-yl)-1-thiophen-3-ylbutan-2-amine (PubChem CID 103494115) has the molecular formula C16H19FN2S and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(6-fluoro-2,3-dihydroindol-1-yl)-1-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)-1-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 103494115 |
| Molecular Formula | C16H19FN2S |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)-1-thiophen-3-ylbutan-2-amine |
| SMILES | CCC(N)C(c1ccsc1)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C16H19FN2S/c1-2-14(18)16(12-6-8-20-10-12)19-7-5-11-3-4-13(17)9-15(11)19/h3-4,6,8-10,14,16H,2,5,7,18H2,1H3 |
| InChIKey | DSQUSUYIRUWURN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |