C14H22N2S — CID 114462399
1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1-thiophen-3-ylbutan-2-amine (PubChem CID 114462399) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 114462399 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1-thiophen-3-ylbutan-2-amine |
| SMILES | CCC(N)C(c1ccsc1)N1CC=C(C)CC1 |
| InChI | InChI=1S/C14H22N2S/c1-3-13(15)14(12-6-9-17-10-12)16-7-4-11(2)5-8-16/h4,6,9-10,13-14H,3,5,7-8,15H2,1-2H3 |
| InChIKey | BSZCYNMJEHKLPP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|