C16H16FNO — CID 103504800
4-[1-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]phenol (PubChem CID 103504800) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-[1-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]phenol.
| Compound Name | 4-[1-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]phenol |
|---|---|
| PubChem CID | 103504800 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[1-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C16H16FNO/c1-11(12-3-6-15(19)7-4-12)18-9-8-13-2-5-14(17)10-16(13)18/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | NADRZVLNXNFKIJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |