C9H15NO4 — CID 103498793
2,3-dimethyl-4-(oxetan-3-ylamino)-4-oxobutanoic acid (PubChem CID 103498793) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2,3-dimethyl-4-(oxetan-3-ylamino)-4-oxobutanoic acid.
| Compound Name | 2,3-dimethyl-4-(oxetan-3-ylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103498793 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2,3-dimethyl-4-(oxetan-3-ylamino)-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)NC1COC1 |
| InChI | InChI=1S/C9H15NO4/c1-5(6(2)9(12)13)8(11)10-7-3-14-4-7/h5-7H,3-4H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | CLPSZGUJHKLXHO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |