C10H18ClNO2 — CID 130655574
N-(4-chlorooxolan-3-yl)-2,3-dimethylbutanamide (PubChem CID 130655574) has the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. Its IUPAC name is N-(4-chlorooxolan-3-yl)-2,3-dimethylbutanamide.
| Compound Name | N-(4-chlorooxolan-3-yl)-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 130655574 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-(4-chlorooxolan-3-yl)-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)NC1COCC1Cl |
| InChI | InChI=1S/C10H18ClNO2/c1-6(2)7(3)10(13)12-9-5-14-4-8(9)11/h6-9H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | NOIOLYXESXNYFA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|