4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid

C13H16FNO4 — CID 103498802

IUPAC4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1ccc(F)c(NC(=O)C(C)C(C)C(=O)O)c1
InChIInChI=1S/C13H16FNO4/c1-7(8(2)13(17)18)12(16)15-11-6-9(19-3)4-5-10(11)14/h4-8H,1-3H3,(H,15,16)(H,17,18)
InChIKeyUDRSHKIRZUUMBV-UHFFFAOYSA-N
MW269.27 g/mol
LogP2.13
Rot. Bonds5

About 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid

4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498802) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103498802
Molecular FormulaC13H16FNO4
Molecular Weight269.27 g/mol
Exact Mass269.11
IUPAC Name4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1ccc(F)c(NC(=O)C(C)C(C)C(=O)O)c1
InChIInChI=1S/C13H16FNO4/c1-7(8(2)13(17)18)12(16)15-11-6-9(19-3)4-5-10(11)14/h4-8H,1-3H3,(H,15,16)(H,17,18)
InChIKeyUDRSHKIRZUUMBV-UHFFFAOYSA-N
XLogP2.13
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.27
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid (CID 103498802) is 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid is COc1ccc(F)c(NC(=O)C(C)C(C)C(=O)O)c1.
What is the InChIKey of 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is UDRSHKIRZUUMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO4/c1-7(8(2)13(17)18)12(16)15-11-6-9(19-3)4-5-10(11)14/h4-8H,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 269.27 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoro-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103498802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).