C48H39N3O6 — CID 10350132
4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-tritylimidazol-4-yl)propanoyl]oxymethyl]benzoic acid (PubChem CID 10350132) has the molecular formula C48H39N3O6 and a molecular weight of 753.86 g/mol. Its IUPAC name is 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-tritylimidazol-4-yl)propanoyl]oxymethyl]benzoic acid.
| Compound Name | 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-tritylimidazol-4-yl)propanoyl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 10350132 |
| Molecular Formula | C48H39N3O6 |
| Molecular Weight | 753.86 g/mol |
| Exact Mass | 753.28 |
| IUPAC Name | 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-tritylimidazol-4-yl)propanoyl]oxymethyl]benzoic acid |
| SMILES | O=C(N[C@@H](Cc1cncn1C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCc1ccc(C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C48H39N3O6/c52-45(53)34-26-24-33(25-27-34)30-56-46(54)44(50-47(55)57-31-43-41-22-12-10-20-39(41)40-21-11-13-23-42(40)43)28-38-29-49-32-51(38)48(35-14-4-1-5-15-35,36-16-6-2-7-17-36)37-18-8-3-9-19-37/h1-27,29,32,43-44H,28,30-31H2,(H,50,55)(H,52,53)/t44-/m0/s1 |
| InChIKey | RBYWOBYQMLUEHU-SJARJILFSA-N |
| XLogP | 8.61 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.86 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|