C17H17FN2 — CID 103504352
1-(6-fluoro-2,3-dihydroindol-1-yl)-2,3-dihydro-1H-inden-5-amine (PubChem CID 103504352) has the molecular formula C17H17FN2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 1-(6-fluoro-2,3-dihydroindol-1-yl)-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 103504352 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)-2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1ccc2c(c1)CCC2N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H17FN2/c18-13-3-1-11-7-8-20(17(11)10-13)16-6-2-12-9-14(19)4-5-15(12)16/h1,3-5,9-10,16H,2,6-8,19H2 |
| InChIKey | OAYDGTAOCLKRKQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|