C14H19FN2 — CID 103503437
1-(azepan-3-yl)-6-fluoro-2,3-dihydroindole (PubChem CID 103503437) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-(azepan-3-yl)-6-fluoro-2,3-dihydroindole.
| Compound Name | 1-(azepan-3-yl)-6-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 103503437 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-(azepan-3-yl)-6-fluoro-2,3-dihydroindole |
| SMILES | Fc1ccc2c(c1)N(C1CCCCNC1)CC2 |
| InChI | InChI=1S/C14H19FN2/c15-12-5-4-11-6-8-17(14(11)9-12)13-3-1-2-7-16-10-13/h4-5,9,13,16H,1-3,6-8,10H2 |
| InChIKey | PQABOASKMHFPLN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |