C15H20FNOS — CID 103504369
[4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]oxan-4-yl]methanethiol (PubChem CID 103504369) has the molecular formula C15H20FNOS and a molecular weight of 281.40 g/mol. Its IUPAC name is [4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]oxan-4-yl]methanethiol.
| Compound Name | [4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]oxan-4-yl]methanethiol |
|---|---|
| PubChem CID | 103504369 |
| Molecular Formula | C15H20FNOS |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]oxan-4-yl]methanethiol |
| SMILES | Fc1ccc2c(c1)N(CC1(CS)CCOCC1)CC2 |
| InChI | InChI=1S/C15H20FNOS/c16-13-2-1-12-3-6-17(14(12)9-13)10-15(11-19)4-7-18-8-5-15/h1-2,9,19H,3-8,10-11H2 |
| InChIKey | VHBCJUSPELUPJZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|