C12H12FN3 — CID 59556823
6-fluoro-1-(1H-imidazol-2-ylmethyl)-2,3-dihydroindole (PubChem CID 59556823) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 6-fluoro-1-(1H-imidazol-2-ylmethyl)-2,3-dihydroindole.
| Compound Name | 6-fluoro-1-(1H-imidazol-2-ylmethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 59556823 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-fluoro-1-(1H-imidazol-2-ylmethyl)-2,3-dihydroindole |
| SMILES | Fc1ccc2c(c1)N(Cc1ncc[nH]1)CC2 |
| InChI | InChI=1S/C12H12FN3/c13-10-2-1-9-3-6-16(11(9)7-10)8-12-14-4-5-15-12/h1-2,4-5,7H,3,6,8H2,(H,14,15) |
| InChIKey | OBQQIQUVBBOBQJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |