C10H17N3O3 — CID 103511037
N-(1,1-dimethoxypropan-2-yl)-3-methylimidazole-4-carboxamide (PubChem CID 103511037) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103511037 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-3-methylimidazole-4-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)c1cncn1C |
| InChI | InChI=1S/C10H17N3O3/c1-7(10(15-3)16-4)12-9(14)8-5-11-6-13(8)2/h5-7,10H,1-4H3,(H,12,14) |
| InChIKey | PZGRWSOODIHSKU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|