C12H20BrN3O — CID 106356199
N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylimidazole-4-carboxamide (PubChem CID 106356199) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 106356199 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)NC(CCBr)C(C)(C)C |
| InChI | InChI=1S/C12H20BrN3O/c1-12(2,3)10(5-6-13)15-11(17)9-7-14-8-16(9)4/h7-8,10H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | CDYGFULUNMZKSI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|