C12H19BrN2OS — CID 106356098
N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 106356098) has the molecular formula C12H19BrN2OS and a molecular weight of 319.27 g/mol. Its IUPAC name is N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 106356098 |
| Molecular Formula | C12H19BrN2OS |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC(CCBr)C(C)(C)C)cs1 |
| InChI | InChI=1S/C12H19BrN2OS/c1-8-14-9(7-17-8)11(16)15-10(5-6-13)12(2,3)4/h7,10H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | MUHJVRWZPIXAPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|