C12H18ClN3O — CID 103512127
N-[1-(chloromethyl)cyclohexyl]-3-methylimidazole-4-carboxamide (PubChem CID 103512127) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclohexyl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[1-(chloromethyl)cyclohexyl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103512127 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-[1-(chloromethyl)cyclohexyl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)NC1(CCl)CCCCC1 |
| InChI | InChI=1S/C12H18ClN3O/c1-16-9-14-7-10(16)11(17)15-12(8-13)5-3-2-4-6-12/h7,9H,2-6,8H2,1H3,(H,15,17) |
| InChIKey | IWTPGWDFCUYXNK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|