C11H20F2N2O2 — CID 103512880
tert-butyl 3-amino-3-(difluoromethyl)piperidine-1-carboxylate (PubChem CID 103512880) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is tert-butyl 3-amino-3-(difluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-3-(difluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103512880 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | tert-butyl 3-amino-3-(difluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N)(C(F)F)C1 |
| InChI | InChI=1S/C11H20F2N2O2/c1-10(2,3)17-9(16)15-6-4-5-11(14,7-15)8(12)13/h8H,4-7,14H2,1-3H3 |
| InChIKey | RRFIWLCFCCRDEL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |