C6H11F2NO3 — CID 103513893
2,2-difluoro-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 103513893) has the molecular formula C6H11F2NO3 and a molecular weight of 183.15 g/mol. Its IUPAC name is 2,2-difluoro-N,N-bis(2-hydroxyethyl)acetamide.
| Compound Name | 2,2-difluoro-N,N-bis(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 103513893 |
| Molecular Formula | C6H11F2NO3 |
| Molecular Weight | 183.15 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2,2-difluoro-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | O=C(C(F)F)N(CCO)CCO |
| InChI | InChI=1S/C6H11F2NO3/c7-5(8)6(12)9(1-3-10)2-4-11/h5,10-11H,1-4H2 |
| InChIKey | NTPRVAAQGKCNLZ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.15 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |