C7H10F5NO2 — CID 91733399
N-ethyl-2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)propanamide (PubChem CID 91733399) has the molecular formula C7H10F5NO2 and a molecular weight of 235.15 g/mol. Its IUPAC name is N-ethyl-2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)propanamide.
| Compound Name | N-ethyl-2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 91733399 |
| Molecular Formula | C7H10F5NO2 |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | N-ethyl-2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)propanamide |
| SMILES | CCN(CCO)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO2/c1-2-13(3-4-14)5(15)6(8,9)7(10,11)12/h14H,2-4H2,1H3 |
| InChIKey | SVNXAOWZEWMTGE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|