C6H8F5NO2 — CID 91730500
2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)-N-methylpropanamide (PubChem CID 91730500) has the molecular formula C6H8F5NO2 and a molecular weight of 221.12 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)-N-methylpropanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 91730500 |
| Molecular Formula | C6H8F5NO2 |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(2-hydroxyethyl)-N-methylpropanamide |
| SMILES | CN(CCO)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO2/c1-12(2-3-13)4(14)5(7,8)6(9,10)11/h13H,2-3H2,1H3 |
| InChIKey | FTBACXWEFJACDL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|