C7H8F7NO2 — CID 91737616
2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)-N-methylbutanamide (PubChem CID 91737616) has the molecular formula C7H8F7NO2 and a molecular weight of 271.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)-N-methylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)-N-methylbutanamide |
|---|---|
| PubChem CID | 91737616 |
| Molecular Formula | C7H8F7NO2 |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)-N-methylbutanamide |
| SMILES | CN(CCO)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F7NO2/c1-15(2-3-16)4(17)5(8,9)6(10,11)7(12,13)14/h16H,2-3H2,1H3 |
| InChIKey | LVLGIETZPOZQTK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|