C7H8F2N2O3 — CID 103514063
4-(2,2-difluoroacetyl)-3-methylpiperazine-2,6-dione (PubChem CID 103514063) has the molecular formula C7H8F2N2O3 and a molecular weight of 206.15 g/mol. Its IUPAC name is 4-(2,2-difluoroacetyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(2,2-difluoroacetyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 103514063 |
| Molecular Formula | C7H8F2N2O3 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4-(2,2-difluoroacetyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)C(F)F |
| InChI | InChI=1S/C7H8F2N2O3/c1-3-6(13)10-4(12)2-11(3)7(14)5(8)9/h3,5H,2H2,1H3,(H,10,12,13) |
| InChIKey | ZOFWALLIANIECC-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|