C10H18F2N2O2 — CID 103514165
N-[2-(4-aminocyclohexyl)oxyethyl]-2,2-difluoroacetamide (PubChem CID 103514165) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-2,2-difluoroacetamide.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103514165 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-2,2-difluoroacetamide |
| SMILES | NC1CCC(OCCNC(=O)C(F)F)CC1 |
| InChI | InChI=1S/C10H18F2N2O2/c11-9(12)10(15)14-5-6-16-8-3-1-7(13)2-4-8/h7-9H,1-6,13H2,(H,14,15) |
| InChIKey | YYOHEQOPDFPHEM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|