C6H7F2NO — CID 103514717
N-but-3-yn-2-yl-2,2-difluoroacetamide (PubChem CID 103514717) has the molecular formula C6H7F2NO and a molecular weight of 147.12 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,2-difluoroacetamide.
| Compound Name | N-but-3-yn-2-yl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103514717 |
| Molecular Formula | C6H7F2NO |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | N-but-3-yn-2-yl-2,2-difluoroacetamide |
| SMILES | C#CC(C)NC(=O)C(F)F |
| InChI | InChI=1S/C6H7F2NO/c1-3-4(2)9-6(10)5(7)8/h1,4-5H,2H3,(H,9,10) |
| InChIKey | WLTBTZVRUGKNEA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|