C7H11F2NOS — CID 103515512
2,2-difluoro-1-(3-methylthiomorpholin-4-yl)ethanone (PubChem CID 103515512) has the molecular formula C7H11F2NOS and a molecular weight of 195.23 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-methylthiomorpholin-4-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(3-methylthiomorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 103515512 |
| Molecular Formula | C7H11F2NOS |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2,2-difluoro-1-(3-methylthiomorpholin-4-yl)ethanone |
| SMILES | CC1CSCCN1C(=O)C(F)F |
| InChI | InChI=1S/C7H11F2NOS/c1-5-4-12-3-2-10(5)7(11)6(8)9/h5-6H,2-4H2,1H3 |
| InChIKey | BLQUGUSJOSTOBP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |