C8H13F2NOS — CID 103516089
1-(2-ethylthiomorpholin-4-yl)-2,2-difluoroethanone (PubChem CID 103516089) has the molecular formula C8H13F2NOS and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-(2-ethylthiomorpholin-4-yl)-2,2-difluoroethanone.
| Compound Name | 1-(2-ethylthiomorpholin-4-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 103516089 |
| Molecular Formula | C8H13F2NOS |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-(2-ethylthiomorpholin-4-yl)-2,2-difluoroethanone |
| SMILES | CCC1CN(C(=O)C(F)F)CCS1 |
| InChI | InChI=1S/C8H13F2NOS/c1-2-6-5-11(3-4-13-6)8(12)7(9)10/h6-7H,2-5H2,1H3 |
| InChIKey | YHKVGBVZNUOKQA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |