C11H10ClF2NO2 — CID 103516192
N-(3-chloro-2-oxo-1-phenylpropyl)-2,2-difluoroacetamide (PubChem CID 103516192) has the molecular formula C11H10ClF2NO2 and a molecular weight of 261.66 g/mol. Its IUPAC name is N-(3-chloro-2-oxo-1-phenylpropyl)-2,2-difluoroacetamide.
| Compound Name | N-(3-chloro-2-oxo-1-phenylpropyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103516192 |
| Molecular Formula | C11H10ClF2NO2 |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-(3-chloro-2-oxo-1-phenylpropyl)-2,2-difluoroacetamide |
| SMILES | O=C(NC(C(=O)CCl)c1ccccc1)C(F)F |
| InChI | InChI=1S/C11H10ClF2NO2/c12-6-8(16)9(15-11(17)10(13)14)7-4-2-1-3-5-7/h1-5,9-10H,6H2,(H,15,17) |
| InChIKey | WGTHFZBCWMBZHA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|