C8H15F2N — CID 103516827
N-ethyl-1,1-difluoro-4-methylpent-4-en-2-amine (PubChem CID 103516827) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is N-ethyl-1,1-difluoro-4-methylpent-4-en-2-amine.
| Compound Name | N-ethyl-1,1-difluoro-4-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 103516827 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | N-ethyl-1,1-difluoro-4-methylpent-4-en-2-amine |
| SMILES | C=C(C)CC(NCC)C(F)F |
| InChI | InChI=1S/C8H15F2N/c1-4-11-7(8(9)10)5-6(2)3/h7-8,11H,2,4-5H2,1,3H3 |
| InChIKey | UTBNHFLRLSVBEY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|