C9H17F2NO2S — CID 103516905
2,2-difluoro-1-(3-methylsulfonylcyclohexyl)ethanamine (PubChem CID 103516905) has the molecular formula C9H17F2NO2S and a molecular weight of 241.30 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-methylsulfonylcyclohexyl)ethanamine.
| Compound Name | 2,2-difluoro-1-(3-methylsulfonylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 103516905 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2,2-difluoro-1-(3-methylsulfonylcyclohexyl)ethanamine |
| SMILES | CS(=O)(=O)C1CCCC(C(N)C(F)F)C1 |
| InChI | InChI=1S/C9H17F2NO2S/c1-15(13,14)7-4-2-3-6(5-7)8(12)9(10)11/h6-9H,2-5,12H2,1H3 |
| InChIKey | QBXMLQWAXYEJQR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |