C12H20BrN3 — CID 103518163
5-bromo-4-N-(3-ethylpentan-2-yl)pyridine-3,4-diamine (PubChem CID 103518163) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 5-bromo-4-N-(3-ethylpentan-2-yl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(3-ethylpentan-2-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518163 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-bromo-4-N-(3-ethylpentan-2-yl)pyridine-3,4-diamine |
| SMILES | CCC(CC)C(C)Nc1c(N)cncc1Br |
| InChI | InChI=1S/C12H20BrN3/c1-4-9(5-2)8(3)16-12-10(13)6-15-7-11(12)14/h6-9H,4-5,14H2,1-3H3,(H,15,16) |
| InChIKey | VQKZRYFYNSCMMY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |