C10H14BrN3 — CID 103518468
5-bromo-4-N-pent-4-en-2-ylpyridine-3,4-diamine (PubChem CID 103518468) has the molecular formula C10H14BrN3 and a molecular weight of 256.15 g/mol. Its IUPAC name is 5-bromo-4-N-pent-4-en-2-ylpyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-pent-4-en-2-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518468 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-bromo-4-N-pent-4-en-2-ylpyridine-3,4-diamine |
| SMILES | C=CCC(C)Nc1c(N)cncc1Br |
| InChI | InChI=1S/C10H14BrN3/c1-3-4-7(2)14-10-8(11)5-13-6-9(10)12/h3,5-7H,1,4,12H2,2H3,(H,13,14) |
| InChIKey | FOHRICCNWNKHOE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|