C11H18BrN3S — CID 103518535
5-bromo-4-N-(4-ethylsulfanylbutan-2-yl)pyridine-3,4-diamine (PubChem CID 103518535) has the molecular formula C11H18BrN3S and a molecular weight of 304.26 g/mol. Its IUPAC name is 5-bromo-4-N-(4-ethylsulfanylbutan-2-yl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(4-ethylsulfanylbutan-2-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518535 |
| Molecular Formula | C11H18BrN3S |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-bromo-4-N-(4-ethylsulfanylbutan-2-yl)pyridine-3,4-diamine |
| SMILES | CCSCCC(C)Nc1c(N)cncc1Br |
| InChI | InChI=1S/C11H18BrN3S/c1-3-16-5-4-8(2)15-11-9(12)6-14-7-10(11)13/h6-8H,3-5,13H2,1-2H3,(H,14,15) |
| InChIKey | JLUDLRXNYBOBOI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|