C9H16O — CID 10351822
1,1,1,3,3-pentadeuterionon-8-en-2-one (PubChem CID 10351822) has the molecular formula C9H16O and a molecular weight of 145.26 g/mol. Its IUPAC name is 1,1,1,3,3-pentadeuterionon-8-en-2-one.
| Compound Name | 1,1,1,3,3-pentadeuterionon-8-en-2-one |
|---|---|
| PubChem CID | 10351822 |
| Molecular Formula | C9H16O |
| Molecular Weight | 145.26 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 1,1,1,3,3-pentadeuterionon-8-en-2-one |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CCCCC=C |
| InChI | InChI=1S/C9H16O/c1-3-4-5-6-7-8-9(2)10/h3H,1,4-8H2,2H3/i2D3,8D2 |
| InChIKey | OIFXLYCBBBXCIB-QCCORQSASA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|