C14H28BrNO2S — CID 103521780
N-[1-(bromomethyl)-3-methylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521780) has the molecular formula C14H28BrNO2S and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521780 |
| Molecular Formula | C14H28BrNO2S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC1CCCC(CBr)(NS(=O)(=O)CCC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28BrNO2S/c1-12-6-5-7-14(10-12,11-15)16-19(17,18)9-8-13(2,3)4/h12,16H,5-11H2,1-4H3 |
| InChIKey | NJAQNUIPDMOGRF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|