C11H22BrNO4S2 — CID 113271073
N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylethanesulfonamide (PubChem CID 113271073) has the molecular formula C11H22BrNO4S2 and a molecular weight of 376.34 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylethanesulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 113271073 |
| Molecular Formula | C11H22BrNO4S2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylethanesulfonamide |
| SMILES | CC1CCCC(CBr)(NS(=O)(=O)CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H22BrNO4S2/c1-10-4-3-5-11(8-10,9-12)13-19(16,17)7-6-18(2,14)15/h10,13H,3-9H2,1-2H3 |
| InChIKey | WHPJOEYDXCDOAD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|