C14H26BrNO2S — CID 113271060
N-[1-(bromomethyl)-3-methylcyclohexyl]cyclohexanesulfonamide (PubChem CID 113271060) has the molecular formula C14H26BrNO2S and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]cyclohexanesulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 113271060 |
| Molecular Formula | C14H26BrNO2S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]cyclohexanesulfonamide |
| SMILES | CC1CCCC(CBr)(NS(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C14H26BrNO2S/c1-12-6-5-9-14(10-12,11-15)16-19(17,18)13-7-3-2-4-8-13/h12-13,16H,2-11H2,1H3 |
| InChIKey | ISASUDQOHQVDJI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|