C15H24BrNO4 — CID 103523455
1-(3-bromo-2,4-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine (PubChem CID 103523455) has the molecular formula C15H24BrNO4 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 103523455 |
| Molecular Formula | C15H24BrNO4 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine |
| SMILES | CCOC(OCC)C(NC)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C15H24BrNO4/c1-6-20-15(21-7-2)13(17-3)10-8-9-11(18-4)12(16)14(10)19-5/h8-9,13,15,17H,6-7H2,1-5H3 |
| InChIKey | KLHPHQJNDRATOQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|