C15H25NO4 — CID 116810595
1-(2,6-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine (PubChem CID 116810595) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 116810595 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-2,2-diethoxy-N-methylethanamine |
| SMILES | CCOC(OCC)C(NC)c1c(OC)cccc1OC |
| InChI | InChI=1S/C15H25NO4/c1-6-19-15(20-7-2)14(16-3)13-11(17-4)9-8-10-12(13)18-5/h8-10,14-16H,6-7H2,1-5H3 |
| InChIKey | ZFIISFTUARIZOK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|