C13H18FN — CID 103527765
N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbut-2-en-1-amine (PubChem CID 103527765) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbut-2-en-1-amine.
| Compound Name | N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 103527765 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbut-2-en-1-amine |
| SMILES | CC(C)=CCNCc1ccc(F)cc1C |
| InChI | InChI=1S/C13H18FN/c1-10(2)6-7-15-9-12-4-5-13(14)8-11(12)3/h4-6,8,15H,7,9H2,1-3H3 |
| InChIKey | ZKECDDBCWJHLPF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|