C9H12F4N2S — CID 103529298
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529298) has the molecular formula C9H12F4N2S and a molecular weight of 256.27 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529298 |
| Molecular Formula | C9H12F4N2S |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | Cc1nc(C)c(CNCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C9H12F4N2S/c1-5-7(16-6(2)15-5)3-14-4-9(12,13)8(10)11/h8,14H,3-4H2,1-2H3 |
| InChIKey | UJOSREMDIJITMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|