C12H14O3 — CID 10352939
(2S)-4-[(E,5S)-5-hydroxyhept-3-en-6-ynyl]-2-methyl-2H-furan-5-one (PubChem CID 10352939) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S)-4-[(E,5S)-5-hydroxyhept-3-en-6-ynyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(E,5S)-5-hydroxyhept-3-en-6-ynyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10352939 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2S)-4-[(E,5S)-5-hydroxyhept-3-en-6-ynyl]-2-methyl-2H-furan-5-one |
| SMILES | C#C[C@@H](O)/C=C/CCC1=C[C@H](C)OC1=O |
| InChI | InChI=1S/C12H14O3/c1-3-11(13)7-5-4-6-10-8-9(2)15-12(10)14/h1,5,7-9,11,13H,4,6H2,2H3/b7-5+/t9-,11+/m0/s1 |
| InChIKey | HXDXTMOGRXPNNT-ACFJMREFSA-N |
| XLogP | 1.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|