C16H16O4 — CID 11097678
(2R)-4-[(2Z,4S,9S)-4,9-dihydroxyundeca-2,10-dien-5,7-diynyl]-2-methyl-2H-furan-5-one (PubChem CID 11097678) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2R)-4-[(2Z,4S,9S)-4,9-dihydroxyundeca-2,10-dien-5,7-diynyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2R)-4-[(2Z,4S,9S)-4,9-dihydroxyundeca-2,10-dien-5,7-diynyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 11097678 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2R)-4-[(2Z,4S,9S)-4,9-dihydroxyundeca-2,10-dien-5,7-diynyl]-2-methyl-2H-furan-5-one |
| SMILES | C=C[C@H](O)C#CC#C[C@@H](O)/C=C\CC1=C[C@@H](C)OC1=O |
| InChI | InChI=1S/C16H16O4/c1-3-14(17)8-4-5-9-15(18)10-6-7-13-11-12(2)20-16(13)19/h3,6,10-12,14-15,17-18H,1,7H2,2H3/b10-6-/t12-,14+,15-/m1/s1 |
| InChIKey | ZVNJQANZWXBDCG-YJPOHDHLSA-N |
| XLogP | 0.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|