C16H14O3 — CID 11821130
(2R)-4-[(Z)-11-hydroxyundec-2-en-5,7,9-triynyl]-2-methyl-2H-furan-5-one (PubChem CID 11821130) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is (2R)-4-[(Z)-11-hydroxyundec-2-en-5,7,9-triynyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2R)-4-[(Z)-11-hydroxyundec-2-en-5,7,9-triynyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 11821130 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2R)-4-[(Z)-11-hydroxyundec-2-en-5,7,9-triynyl]-2-methyl-2H-furan-5-one |
| SMILES | C[C@@H]1C=C(C/C=C\CC#CC#CC#CCO)C(=O)O1 |
| InChI | InChI=1S/C16H14O3/c1-14-13-15(16(18)19-14)11-9-7-5-3-2-4-6-8-10-12-17/h7,9,13-14,17H,5,11-12H2,1H3/b9-7-/t14-/m1/s1 |
| InChIKey | ZGKQPJRZFFMQMR-IUCKJTJTSA-N |
| XLogP | 1.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|