C13H22F4N2 — CID 103529443
1-(3-methylbut-2-enyl)-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine (PubChem CID 103529443) has the molecular formula C13H22F4N2 and a molecular weight of 282.32 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 103529443 |
| Molecular Formula | C13H22F4N2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C13H22F4N2/c1-10(2)3-6-19-7-4-11(5-8-19)18-9-13(16,17)12(14)15/h3,11-12,18H,4-9H2,1-2H3 |
| InChIKey | HZDCWPWZWJGGJT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|