C13H23F3N2S — CID 103778106
1-(3-methylbut-2-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine (PubChem CID 103778106) has the molecular formula C13H23F3N2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 103778106 |
| Molecular Formula | C13H23F3N2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N2S/c1-11(2)3-7-18-8-4-12(5-9-18)17-6-10-19-13(14,15)16/h3,12,17H,4-10H2,1-2H3 |
| InChIKey | AVSSBUFCIQWORQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|