C15H27F3N2 — CID 115516869
1-(3-methylbut-2-enyl)-N-(5,5,5-trifluoropentyl)piperidin-4-amine (PubChem CID 115516869) has the molecular formula C15H27F3N2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-(5,5,5-trifluoropentyl)piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-(5,5,5-trifluoropentyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115516869 |
| Molecular Formula | C15H27F3N2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-(5,5,5-trifluoropentyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H27F3N2/c1-13(2)5-10-20-11-6-14(7-12-20)19-9-4-3-8-15(16,17)18/h5,14,19H,3-4,6-12H2,1-2H3 |
| InChIKey | CZGOMYRILNFZHR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|