C12H22F2N2 — CID 115405685
N-(2,2-difluoroethyl)-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 115405685) has the molecular formula C12H22F2N2 and a molecular weight of 232.32 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-(3-methylbut-2-enyl)piperidin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)-1-(3-methylbut-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115405685 |
| Molecular Formula | C12H22F2N2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCC(F)F)CC1 |
| InChI | InChI=1S/C12H22F2N2/c1-10(2)3-6-16-7-4-11(5-8-16)15-9-12(13)14/h3,11-12,15H,4-9H2,1-2H3 |
| InChIKey | KADCCHCTLUMGGL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|