C12H21F3N2S — CID 103914417
N-(2-prop-2-enylsulfanylethyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 103914417) has the molecular formula C12H21F3N2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(2-prop-2-enylsulfanylethyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(2-prop-2-enylsulfanylethyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 103914417 |
| Molecular Formula | C12H21F3N2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(2-prop-2-enylsulfanylethyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | C=CCSCCNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2S/c1-2-8-18-9-5-16-11-3-6-17(7-4-11)10-12(13,14)15/h2,11,16H,1,3-10H2 |
| InChIKey | SUTQEVRSTINDEU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|